C19H20N2O5S — CID 42603458
2-[2-[(2-methoxy-5-methylphenyl)carbamothioyloxy]ethylcarbamoyl]benzoic acid (PubChem CID 42603458) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[2-[(2-methoxy-5-methylphenyl)carbamothioyloxy]ethylcarbamoyl]benzoic acid.
| Compound Name | 2-[2-[(2-methoxy-5-methylphenyl)carbamothioyloxy]ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 42603458 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[2-[(2-methoxy-5-methylphenyl)carbamothioyloxy]ethylcarbamoyl]benzoic acid |
| SMILES | COc1ccc(C)cc1NC(=S)OCCNC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C19H20N2O5S/c1-12-7-8-16(25-2)15(11-12)21-19(27)26-10-9-20-17(22)13-5-3-4-6-14(13)18(23)24/h3-8,11H,9-10H2,1-2H3,(H,20,22)(H,21,27)(H,23,24) |
| InChIKey | GUBKDYSSWDOPPO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|