C15H20N2S — CID 5279304
4-[(3,5-dimethylphenyl)methyl]-5-propan-2-yl-1,3-dihydroimidazole-2-thione (PubChem CID 5279304) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)methyl]-5-propan-2-yl-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[(3,5-dimethylphenyl)methyl]-5-propan-2-yl-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 5279304 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)methyl]-5-propan-2-yl-1,3-dihydroimidazole-2-thione |
| SMILES | Cc1cc(C)cc(Cc2[nH]c(=S)[nH]c2C(C)C)c1 |
| InChI | InChI=1S/C15H20N2S/c1-9(2)14-13(16-15(18)17-14)8-12-6-10(3)5-11(4)7-12/h5-7,9H,8H2,1-4H3,(H2,16,17,18) |
| InChIKey | JCISVXJNCCQILM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|