C22H15ClN4O4 — CID 5279335
N-[5-(3-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]-2-nitrobenzamide (PubChem CID 5279335) has the molecular formula C22H15ClN4O4 and a molecular weight of 434.84 g/mol. Its IUPAC name is N-[5-(3-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]-2-nitrobenzamide.
| Compound Name | N-[5-(3-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 5279335 |
| Molecular Formula | C22H15ClN4O4 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[5-(3-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]-2-nitrobenzamide |
| SMILES | O=C(NC1N=C(c2cccc(Cl)c2)c2ccccc2NC1=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15ClN4O4/c23-14-7-5-6-13(12-14)19-15-8-1-3-10-17(15)24-22(29)20(25-19)26-21(28)16-9-2-4-11-18(16)27(30)31/h1-12,20H,(H,24,29)(H,26,28) |
| InChIKey | HLRDJPRLORRVKQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|