C27H24Cl2FN3O5 — CID 50995043
N-[5-(2,4-dichloro-6-ethoxyphenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]-5-fluoro-2-(2-methoxyethoxy)benzamide (PubChem CID 50995043) has the molecular formula C27H24Cl2FN3O5 and a molecular weight of 560.41 g/mol. Its IUPAC name is N-[5-(2,4-dichloro-6-ethoxyphenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]-5-fluoro-2-(2-methoxyethoxy)benzamide.
| Compound Name | N-[5-(2,4-dichloro-6-ethoxyphenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]-5-fluoro-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 50995043 |
| Molecular Formula | C27H24Cl2FN3O5 |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | N-[5-(2,4-dichloro-6-ethoxyphenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-3-yl]-5-fluoro-2-(2-methoxyethoxy)benzamide |
| SMILES | CCOc1cc(Cl)cc(Cl)c1C1=NC(NC(=O)c2cc(F)ccc2OCCOC)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C27H24Cl2FN3O5/c1-3-37-22-13-15(28)12-19(29)23(22)24-17-6-4-5-7-20(17)31-27(35)25(32-24)33-26(34)18-14-16(30)8-9-21(18)38-11-10-36-2/h4-9,12-14,25H,3,10-11H2,1-2H3,(H,31,35)(H,33,34) |
| InChIKey | RAGAWIYPCSWWAJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|