C26H21Cl4N3O4 — CID 58176440
5-chloro-2-(2-ethoxyethoxy)-N-[2-oxo-5-(2,4,6-trichlorophenyl)-1,3-dihydro-1,4-benzodiazepin-3-yl]benzamide (PubChem CID 58176440) has the molecular formula C26H21Cl4N3O4 and a molecular weight of 581.28 g/mol. Its IUPAC name is 5-chloro-2-(2-ethoxyethoxy)-N-[2-oxo-5-(2,4,6-trichlorophenyl)-1,3-dihydro-1,4-benzodiazepin-3-yl]benzamide.
| Compound Name | 5-chloro-2-(2-ethoxyethoxy)-N-[2-oxo-5-(2,4,6-trichlorophenyl)-1,3-dihydro-1,4-benzodiazepin-3-yl]benzamide |
|---|---|
| PubChem CID | 58176440 |
| Molecular Formula | C26H21Cl4N3O4 |
| Molecular Weight | 581.28 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | 5-chloro-2-(2-ethoxyethoxy)-N-[2-oxo-5-(2,4,6-trichlorophenyl)-1,3-dihydro-1,4-benzodiazepin-3-yl]benzamide |
| SMILES | CCOCCOc1ccc(Cl)cc1C(=O)NC1N=C(c2c(Cl)cc(Cl)cc2Cl)c2ccccc2NC1=O |
| InChI | InChI=1S/C26H21Cl4N3O4/c1-2-36-9-10-37-21-8-7-14(27)11-17(21)25(34)33-24-26(35)31-20-6-4-3-5-16(20)23(32-24)22-18(29)12-15(28)13-19(22)30/h3-8,11-13,24H,2,9-10H2,1H3,(H,31,35)(H,33,34) |
| InChIKey | XZBFZGXCERYYRO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.28 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|