C26H20Cl4N2O4 — CID 58176426
5-chloro-2-(2-methoxyethoxy)-N-[(3R)-4-oxo-1-(2,4,6-trichlorophenyl)-3,5-dihydro-2-benzazepin-3-yl]benzamide (PubChem CID 58176426) has the molecular formula C26H20Cl4N2O4 and a molecular weight of 566.27 g/mol. Its IUPAC name is 5-chloro-2-(2-methoxyethoxy)-N-[(3R)-4-oxo-1-(2,4,6-trichlorophenyl)-3,5-dihydro-2-benzazepin-3-yl]benzamide.
| Compound Name | 5-chloro-2-(2-methoxyethoxy)-N-[(3R)-4-oxo-1-(2,4,6-trichlorophenyl)-3,5-dihydro-2-benzazepin-3-yl]benzamide |
|---|---|
| PubChem CID | 58176426 |
| Molecular Formula | C26H20Cl4N2O4 |
| Molecular Weight | 566.27 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | 5-chloro-2-(2-methoxyethoxy)-N-[(3R)-4-oxo-1-(2,4,6-trichlorophenyl)-3,5-dihydro-2-benzazepin-3-yl]benzamide |
| SMILES | COCCOc1ccc(Cl)cc1C(=O)N[C@@H]1N=C(c2c(Cl)cc(Cl)cc2Cl)c2ccccc2CC1=O |
| InChI | InChI=1S/C26H20Cl4N2O4/c1-35-8-9-36-22-7-6-15(27)11-18(22)26(34)32-25-21(33)10-14-4-2-3-5-17(14)24(31-25)23-19(29)12-16(28)13-20(23)30/h2-7,11-13,25H,8-10H2,1H3,(H,32,34)/t25-/m0/s1 |
| InChIKey | BMGMROILBGYPNY-VWLOTQADSA-N |
| XLogP | 6.04 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.27 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|