C28H25Cl2FN2O5 — CID 58176450
N-[1-(2,4-dichloro-6-ethoxyphenyl)-4-oxo-3,5-dihydro-2-benzazepin-3-yl]-5-fluoro-2-(2-methoxyethoxy)benzamide (PubChem CID 58176450) has the molecular formula C28H25Cl2FN2O5 and a molecular weight of 559.42 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-6-ethoxyphenyl)-4-oxo-3,5-dihydro-2-benzazepin-3-yl]-5-fluoro-2-(2-methoxyethoxy)benzamide.
| Compound Name | N-[1-(2,4-dichloro-6-ethoxyphenyl)-4-oxo-3,5-dihydro-2-benzazepin-3-yl]-5-fluoro-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 58176450 |
| Molecular Formula | C28H25Cl2FN2O5 |
| Molecular Weight | 559.42 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | N-[1-(2,4-dichloro-6-ethoxyphenyl)-4-oxo-3,5-dihydro-2-benzazepin-3-yl]-5-fluoro-2-(2-methoxyethoxy)benzamide |
| SMILES | CCOc1cc(Cl)cc(Cl)c1C1=NC(NC(=O)c2cc(F)ccc2OCCOC)C(=O)Cc2ccccc21 |
| InChI | InChI=1S/C28H25Cl2FN2O5/c1-3-37-24-14-17(29)13-21(30)25(24)26-19-7-5-4-6-16(19)12-22(34)27(32-26)33-28(35)20-15-18(31)8-9-23(20)38-11-10-36-2/h4-9,13-15,27H,3,10-12H2,1-2H3,(H,33,35) |
| InChIKey | AGRNPFSHOJREGF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|