About 2-chloro-4-methylquinoline-5,8-dione
2-chloro-4-methylquinoline-5,8-dione (PubChem CID 5279447) has the molecular formula C10H6ClNO2
and a molecular weight of 207.62 g/mol. Its IUPAC name is 2-chloro-4-methylquinoline-5,8-dione.
Molecular Properties
| Compound Name | 2-chloro-4-methylquinoline-5,8-dione |
| PubChem CID | 5279447 |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.62 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 2-chloro-4-methylquinoline-5,8-dione |
| SMILES | Cc1cc(Cl)nc2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C10H6ClNO2/c1-5-4-8(11)12-10-7(14)3-2-6(13)9(5)10/h2-4H,1H3 |
| InChIKey | VKVAWGYZXSHGNH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-methylquinoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methylquinoline-5,8-dione?
The IUPAC name of 2-chloro-4-methylquinoline-5,8-dione (CID 5279447) is 2-chloro-4-methylquinoline-5,8-dione.
What is the SMILES notation for 2-chloro-4-methylquinoline-5,8-dione?
The canonical SMILES for 2-chloro-4-methylquinoline-5,8-dione is Cc1cc(Cl)nc2c1C(=O)C=CC2=O.
What is the InChIKey of 2-chloro-4-methylquinoline-5,8-dione?
The InChIKey is VKVAWGYZXSHGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO2/c1-5-4-8(11)12-10-7(14)3-2-6(13)9(5)10/h2-4H,1H3.
What are the key properties of 2-chloro-4-methylquinoline-5,8-dione?
2-chloro-4-methylquinoline-5,8-dione has a molecular weight of 207.62 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methylquinoline-5,8-dione is sourced from PubChem (CID 5279447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).