C18H22N4OS — CID 5279692
6-methyl-2-[[2-(3-methylsulfanylpropylamino)benzimidazol-1-yl]methyl]pyridin-3-ol (PubChem CID 5279692) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 6-methyl-2-[[2-(3-methylsulfanylpropylamino)benzimidazol-1-yl]methyl]pyridin-3-ol.
| Compound Name | 6-methyl-2-[[2-(3-methylsulfanylpropylamino)benzimidazol-1-yl]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 5279692 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 6-methyl-2-[[2-(3-methylsulfanylpropylamino)benzimidazol-1-yl]methyl]pyridin-3-ol |
| SMILES | CSCCCNc1nc2ccccc2n1Cc1nc(C)ccc1O |
| InChI | InChI=1S/C18H22N4OS/c1-13-8-9-17(23)15(20-13)12-22-16-7-4-3-6-14(16)21-18(22)19-10-5-11-24-2/h3-4,6-9,23H,5,10-12H2,1-2H3,(H,19,21) |
| InChIKey | GXQCYPLCHNPBHW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|