About 4-hydroxyfuro[3,2-g]chromen-7-one
4-hydroxyfuro[3,2-g]chromen-7-one (PubChem CID 5280371) has the molecular formula C11H6O4
and a molecular weight of 202.17 g/mol. Its IUPAC name is 4-hydroxyfuro[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 4-hydroxyfuro[3,2-g]chromen-7-one |
| PubChem CID | 5280371 |
| Molecular Formula | C11H6O4 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 4-hydroxyfuro[3,2-g]chromen-7-one |
| SMILES | O=c1ccc2c(O)c3ccoc3cc2o1 |
| InChI | InChI=1S/C11H6O4/c12-10-2-1-6-9(15-10)5-8-7(11(6)13)3-4-14-8/h1-5,13H |
| InChIKey | GIJHDGJRTUSBJR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyfuro[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyfuro[3,2-g]chromen-7-one?
The IUPAC name of 4-hydroxyfuro[3,2-g]chromen-7-one (CID 5280371) is 4-hydroxyfuro[3,2-g]chromen-7-one.
What is the SMILES notation for 4-hydroxyfuro[3,2-g]chromen-7-one?
The canonical SMILES for 4-hydroxyfuro[3,2-g]chromen-7-one is O=c1ccc2c(O)c3ccoc3cc2o1.
What is the InChIKey of 4-hydroxyfuro[3,2-g]chromen-7-one?
The InChIKey is GIJHDGJRTUSBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6O4/c12-10-2-1-6-9(15-10)5-8-7(11(6)13)3-4-14-8/h1-5,13H.
What are the key properties of 4-hydroxyfuro[3,2-g]chromen-7-one?
4-hydroxyfuro[3,2-g]chromen-7-one has a molecular weight of 202.17 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyfuro[3,2-g]chromen-7-one is sourced from PubChem (CID 5280371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).