C23H23FN2O2S — CID 52804465
5-(2-fluorophenyl)-N-[2-methyl-4-(2-methylpropylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 52804465) has the molecular formula C23H23FN2O2S and a molecular weight of 410.51 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-[2-methyl-4-(2-methylpropylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-[2-methyl-4-(2-methylpropylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 52804465 |
| Molecular Formula | C23H23FN2O2S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 5-(2-fluorophenyl)-N-[2-methyl-4-(2-methylpropylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)c1ccc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C23H23FN2O2S/c1-14(2)13-25-22(27)16-8-9-19(15(3)12-16)26-23(28)21-11-10-20(29-21)17-6-4-5-7-18(17)24/h4-12,14H,13H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | MSSOKUVHAJOXSH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |