C20H23N5O2 — CID 52812350
1-[4-[(E)-3-oxo-3-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]prop-1-enyl]phenyl]pyrrolidin-2-one (PubChem CID 52812350) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 1-[4-[(E)-3-oxo-3-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]prop-1-enyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(E)-3-oxo-3-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]prop-1-enyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 52812350 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-[4-[(E)-3-oxo-3-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]prop-1-enyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C(/C=C/c1ccc(N2CCCC2=O)cc1)N1CCC(n2cncn2)CC1 |
| InChI | InChI=1S/C20H23N5O2/c26-19(23-12-9-18(10-13-23)25-15-21-14-22-25)8-5-16-3-6-17(7-4-16)24-11-1-2-20(24)27/h3-8,14-15,18H,1-2,9-13H2/b8-5+ |
| InChIKey | CGXGAGJXYVHQOX-VMPITWQZSA-N |
| XLogP | 2.28 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|