C17H26O3Si — CID 528205
2,2-ditert-butyl-5,8-dimethyl-1,3,2-benzodioxasilin-4-one (PubChem CID 528205) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is 2,2-ditert-butyl-5,8-dimethyl-1,3,2-benzodioxasilin-4-one.
| Compound Name | 2,2-ditert-butyl-5,8-dimethyl-1,3,2-benzodioxasilin-4-one |
|---|---|
| PubChem CID | 528205 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2,2-ditert-butyl-5,8-dimethyl-1,3,2-benzodioxasilin-4-one |
| SMILES | Cc1ccc(C)c2c1O[Si](C(C)(C)C)(C(C)(C)C)OC2=O |
| InChI | InChI=1S/C17H26O3Si/c1-11-9-10-12(2)14-13(11)15(18)20-21(19-14,16(3,4)5)17(6,7)8/h9-10H,1-8H3 |
| InChIKey | UMYUCQMALOGMND-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|