C15H12F2INO2 — CID 52824087
N-(3,5-difluoro-4-iodophenyl)-2-(methoxymethyl)benzamide (PubChem CID 52824087) has the molecular formula C15H12F2INO2 and a molecular weight of 403.17 g/mol. Its IUPAC name is N-(3,5-difluoro-4-iodophenyl)-2-(methoxymethyl)benzamide.
| Compound Name | N-(3,5-difluoro-4-iodophenyl)-2-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 52824087 |
| Molecular Formula | C15H12F2INO2 |
| Molecular Weight | 403.17 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | N-(3,5-difluoro-4-iodophenyl)-2-(methoxymethyl)benzamide |
| SMILES | COCc1ccccc1C(=O)Nc1cc(F)c(I)c(F)c1 |
| InChI | InChI=1S/C15H12F2INO2/c1-21-8-9-4-2-3-5-11(9)15(20)19-10-6-12(16)14(18)13(17)7-10/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | KCTWYUFXCGXPFG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.17 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|