C21H23Cl2N3O3S — CID 52826288
5-[[4-(3-chloro-4-methoxyphenyl)-5-(5-chloro-2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentan-1-ol (PubChem CID 52826288) has the molecular formula C21H23Cl2N3O3S and a molecular weight of 468.41 g/mol. Its IUPAC name is 5-[[4-(3-chloro-4-methoxyphenyl)-5-(5-chloro-2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentan-1-ol.
| Compound Name | 5-[[4-(3-chloro-4-methoxyphenyl)-5-(5-chloro-2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentan-1-ol |
|---|---|
| PubChem CID | 52826288 |
| Molecular Formula | C21H23Cl2N3O3S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 5-[[4-(3-chloro-4-methoxyphenyl)-5-(5-chloro-2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentan-1-ol |
| SMILES | COc1ccc(-n2c(SCCCCCO)nnc2-c2cc(Cl)ccc2OC)cc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O3S/c1-28-18-8-6-14(22)12-16(18)20-24-25-21(30-11-5-3-4-10-27)26(20)15-7-9-19(29-2)17(23)13-15/h6-9,12-13,27H,3-5,10-11H2,1-2H3 |
| InChIKey | HXGSNQVHUZURJH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|