About 4-O-benzyl 1-O-methyl butanedioate
4-O-benzyl 1-O-methyl butanedioate (PubChem CID 528264) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-O-benzyl 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-benzyl 1-O-methyl butanedioate |
| PubChem CID | 528264 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-O-benzyl 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H14O4/c1-15-11(13)7-8-12(14)16-9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | MUXGHJRHNFYSBX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-O-benzyl 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-benzyl 1-O-methyl butanedioate?
The IUPAC name of 4-O-benzyl 1-O-methyl butanedioate (CID 528264) is 4-O-benzyl 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-benzyl 1-O-methyl butanedioate?
The canonical SMILES for 4-O-benzyl 1-O-methyl butanedioate is COC(=O)CCC(=O)OCc1ccccc1.
What is the InChIKey of 4-O-benzyl 1-O-methyl butanedioate?
The InChIKey is MUXGHJRHNFYSBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-15-11(13)7-8-12(14)16-9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3.
What are the key properties of 4-O-benzyl 1-O-methyl butanedioate?
4-O-benzyl 1-O-methyl butanedioate has a molecular weight of 222.24 g/mol, XLogP of 1.68, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-benzyl 1-O-methyl butanedioate is sourced from PubChem (CID 528264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).