C24H38O4Si3 — CID 528420
1-phenyl-3-[2,4,6-tris(trimethylsilyloxy)phenyl]propan-1-one (PubChem CID 528420) has the molecular formula C24H38O4Si3 and a molecular weight of 474.82 g/mol. Its IUPAC name is 1-phenyl-3-[2,4,6-tris(trimethylsilyloxy)phenyl]propan-1-one.
| Compound Name | 1-phenyl-3-[2,4,6-tris(trimethylsilyloxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 528420 |
| Molecular Formula | C24H38O4Si3 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-phenyl-3-[2,4,6-tris(trimethylsilyloxy)phenyl]propan-1-one |
| SMILES | C[Si](C)(C)Oc1cc(O[Si](C)(C)C)c(CCC(=O)c2ccccc2)c(O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C24H38O4Si3/c1-29(2,3)26-20-17-23(27-30(4,5)6)21(24(18-20)28-31(7,8)9)15-16-22(25)19-13-11-10-12-14-19/h10-14,17-18H,15-16H2,1-9H3 |
| InChIKey | ZYBAQBXRVHCGHQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|