About 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride
3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride (PubChem CID 5284401) has the molecular formula C8H20ClNO6S2
and a molecular weight of 325.84 g/mol. Its IUPAC name is 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride.
Molecular Properties
| Compound Name | 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride |
| PubChem CID | 5284401 |
| Molecular Formula | C8H20ClNO6S2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride |
| SMILES | CS(=O)(=O)OCCCNCCCOS(C)(=O)=O.Cl |
| InChI | InChI=1S/C8H19NO6S2.ClH/c1-16(10,11)14-7-3-5-9-6-4-8-15-17(2,12)13;/h9H,3-8H2,1-2H3;1H |
| InChIKey | YWCASUPWYFFUHE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride?
The IUPAC name of 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride (CID 5284401) is 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride.
What is the SMILES notation for 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride?
The canonical SMILES for 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride is CS(=O)(=O)OCCCNCCCOS(C)(=O)=O.Cl.
What is the InChIKey of 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride?
The InChIKey is YWCASUPWYFFUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO6S2.ClH/c1-16(10,11)14-7-3-5-9-6-4-8-15-17(2,12)13;/h9H,3-8H2,1-2H3;1H.
What are the key properties of 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride?
3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride has a molecular weight of 325.84 g/mol, XLogP of -0.27, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylsulfonyloxypropylamino)propyl methanesulfonate;hydrochloride is sourced from PubChem (CID 5284401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).