C10H24N2O8S2 — CID 6336301
2-[[(2R,3R)-2,3-dihydroxy-4-(2-methylsulfonyloxyethylamino)butyl]amino]ethyl methanesulfonate (PubChem CID 6336301) has the molecular formula C10H24N2O8S2 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[[(2R,3R)-2,3-dihydroxy-4-(2-methylsulfonyloxyethylamino)butyl]amino]ethyl methanesulfonate.
| Compound Name | 2-[[(2R,3R)-2,3-dihydroxy-4-(2-methylsulfonyloxyethylamino)butyl]amino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 6336301 |
| Molecular Formula | C10H24N2O8S2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-[[(2R,3R)-2,3-dihydroxy-4-(2-methylsulfonyloxyethylamino)butyl]amino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCNC[C@@H](O)[C@H](O)CNCCOS(C)(=O)=O |
| InChI | InChI=1S/C10H24N2O8S2/c1-21(15,16)19-5-3-11-7-9(13)10(14)8-12-4-6-20-22(2,17)18/h9-14H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | BYZJBHCTZJGJFV-NXEZZACHSA-N |
| XLogP | -3.16 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|