C18H17NO4 — CID 52868718
N-[4-(2-hydroxyethyl)phenyl]-2-[(1R)-3-oxo-1H-2-benzofuran-1-yl]acetamide (PubChem CID 52868718) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[4-(2-hydroxyethyl)phenyl]-2-[(1R)-3-oxo-1H-2-benzofuran-1-yl]acetamide.
| Compound Name | N-[4-(2-hydroxyethyl)phenyl]-2-[(1R)-3-oxo-1H-2-benzofuran-1-yl]acetamide |
|---|---|
| PubChem CID | 52868718 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[4-(2-hydroxyethyl)phenyl]-2-[(1R)-3-oxo-1H-2-benzofuran-1-yl]acetamide |
| SMILES | O=C(C[C@H]1OC(=O)c2ccccc21)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C18H17NO4/c20-10-9-12-5-7-13(8-6-12)19-17(21)11-16-14-3-1-2-4-15(14)18(22)23-16/h1-8,16,20H,9-11H2,(H,19,21)/t16-/m1/s1 |
| InChIKey | MEIQBPSUVKXENI-MRXNPFEDSA-N |
| XLogP | 2.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |