C20H16N4O5S — CID 41297251
2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 41297251) has the molecular formula C20H16N4O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is 2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 41297251 |
| Molecular Formula | C20H16N4O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(C[C@@H]1OC(=O)c2ccccc21)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C20H16N4O5S/c25-18(12-17-15-4-1-2-5-16(15)19(26)29-17)23-13-6-8-14(9-7-13)30(27,28)24-20-21-10-3-11-22-20/h1-11,17H,12H2,(H,23,25)(H,21,22,24)/t17-/m0/s1 |
| InChIKey | BETCJSXMULWSSI-KRWDZBQOSA-N |
| XLogP | 2.52 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |