C19H15N3O4S — CID 1213546
4-[[(1S)-3-oxo-1H-2-benzofuran-1-yl]amino]-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 1213546) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is 4-[[(1S)-3-oxo-1H-2-benzofuran-1-yl]amino]-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 4-[[(1S)-3-oxo-1H-2-benzofuran-1-yl]amino]-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 1213546 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-[[(1S)-3-oxo-1H-2-benzofuran-1-yl]amino]-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | O=C1O[C@H](Nc2ccc(S(=O)(=O)Nc3ccccn3)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H15N3O4S/c23-19-16-6-2-1-5-15(16)18(26-19)21-13-8-10-14(11-9-13)27(24,25)22-17-7-3-4-12-20-17/h1-12,18,21H,(H,20,22)/t18-/m0/s1 |
| InChIKey | TYARHTVRLDOZJF-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |