C12H11N3O2 — CID 40612411
(3S)-3-[(5-methyl-1H-pyrazol-3-yl)amino]-3H-2-benzofuran-1-one (PubChem CID 40612411) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is (3S)-3-[(5-methyl-1H-pyrazol-3-yl)amino]-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-[(5-methyl-1H-pyrazol-3-yl)amino]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 40612411 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (3S)-3-[(5-methyl-1H-pyrazol-3-yl)amino]-3H-2-benzofuran-1-one |
| SMILES | Cc1cc(N[C@H]2OC(=O)c3ccccc32)n[nH]1 |
| InChI | InChI=1S/C12H11N3O2/c1-7-6-10(15-14-7)13-11-8-4-2-3-5-9(8)12(16)17-11/h2-6,11H,1H3,(H2,13,14,15)/t11-/m0/s1 |
| InChIKey | WFMPORCEPVZMOZ-NSHDSACASA-N |
| XLogP | 2.00 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |