C18H17N3 — CID 52878167
3-methyl-5-phenyl-1-[(E)-3-phenylprop-2-enyl]-1,2,4-triazole (PubChem CID 52878167) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-methyl-5-phenyl-1-[(E)-3-phenylprop-2-enyl]-1,2,4-triazole.
| Compound Name | 3-methyl-5-phenyl-1-[(E)-3-phenylprop-2-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 52878167 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-methyl-5-phenyl-1-[(E)-3-phenylprop-2-enyl]-1,2,4-triazole |
| SMILES | Cc1nc(-c2ccccc2)n(C/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C18H17N3/c1-15-19-18(17-12-6-3-7-13-17)21(20-15)14-8-11-16-9-4-2-5-10-16/h2-13H,14H2,1H3/b11-8+ |
| InChIKey | OYBXVUUJYPMXPZ-DHZHZOJOSA-N |
| XLogP | 3.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |