About 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid
2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid (PubChem CID 82512631) has the molecular formula C11H11N3O2
and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid |
| PubChem CID | 82512631 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid |
| SMILES | Cc1nc(-c2ccccc2)n(CC(=O)O)n1 |
| InChI | InChI=1S/C11H11N3O2/c1-8-12-11(9-5-3-2-4-6-9)14(13-8)7-10(15)16/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | QPITUDGTOOFQON-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid?
The IUPAC name of 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid (CID 82512631) is 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid.
What is the SMILES notation for 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid?
The canonical SMILES for 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid is Cc1nc(-c2ccccc2)n(CC(=O)O)n1.
What is the InChIKey of 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid?
The InChIKey is QPITUDGTOOFQON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2/c1-8-12-11(9-5-3-2-4-6-9)14(13-8)7-10(15)16/h2-6H,7H2,1H3,(H,15,16).
What are the key properties of 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid?
2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid has a molecular weight of 217.23 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-5-phenyl-1,2,4-triazol-1-yl)acetic acid is sourced from PubChem (CID 82512631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).