C21H41O4- — CID 5288835
(2R)-2,3-dihydroxy-1-[(Z)-octadec-9-enoxy]propan-1-olate (PubChem CID 5288835) has the molecular formula C21H41O4- and a molecular weight of 357.56 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-1-[(Z)-octadec-9-enoxy]propan-1-olate.
| Compound Name | (2R)-2,3-dihydroxy-1-[(Z)-octadec-9-enoxy]propan-1-olate |
|---|---|
| PubChem CID | 5288835 |
| Molecular Formula | C21H41O4- |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | (2R)-2,3-dihydroxy-1-[(Z)-octadec-9-enoxy]propan-1-olate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC([O-])[C@H](O)CO |
| InChI | InChI=1S/C21H41O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-21(24)20(23)19-22/h9-10,20-23H,2-8,11-19H2,1H3/q-1/b10-9-/t20-,21?/m1/s1 |
| InChIKey | PYFJVYKXOSXEGA-HLRGCEFASA-N |
| XLogP | 4.08 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|