C22H15F3N4O3 — CID 52888394
2-(1-formylnaphthalen-2-yl)oxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 52888394) has the molecular formula C22H15F3N4O3 and a molecular weight of 440.38 g/mol. Its IUPAC name is 2-(1-formylnaphthalen-2-yl)oxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1-formylnaphthalen-2-yl)oxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 52888394 |
| Molecular Formula | C22H15F3N4O3 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-(1-formylnaphthalen-2-yl)oxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=Cc1c(OCC(=O)Nc2cc(C(F)(F)F)ccc2-n2cncn2)ccc2ccccc12 |
| InChI | InChI=1S/C22H15F3N4O3/c23-22(24,25)15-6-7-19(29-13-26-12-27-29)18(9-15)28-21(31)11-32-20-8-5-14-3-1-2-4-16(14)17(20)10-30/h1-10,12-13H,11H2,(H,28,31) |
| InChIKey | LCBKRWSTCLAWNF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|