C20H15ClN4O2 — CID 8794748
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 8794748) has the molecular formula C20H15ClN4O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 8794748 |
| Molecular Formula | C20H15ClN4O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C20H15ClN4O2/c21-16-6-8-19(25-13-22-12-23-25)18(10-16)24-20(26)11-27-17-7-5-14-3-1-2-4-15(14)9-17/h1-10,12-13H,11H2,(H,24,26) |
| InChIKey | OYTYRALZFPEFGY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |