C17H13ClF3N3OS — CID 52890871
4-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]-1-phenylbutan-1-one (PubChem CID 52890871) has the molecular formula C17H13ClF3N3OS and a molecular weight of 399.83 g/mol. Its IUPAC name is 4-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]-1-phenylbutan-1-one.
| Compound Name | 4-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 52890871 |
| Molecular Formula | C17H13ClF3N3OS |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 4-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]-1-phenylbutan-1-one |
| SMILES | O=C(CCCSc1nnc2c(Cl)cc(C(F)(F)F)cn12)c1ccccc1 |
| InChI | InChI=1S/C17H13ClF3N3OS/c18-13-9-12(17(19,20)21)10-24-15(13)22-23-16(24)26-8-4-7-14(25)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2 |
| InChIKey | ZTEBAANDVMKVJE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|