C10H7ClF3N3S — CID 78766306
8-chloro-3-prop-2-enylsulfanyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 78766306) has the molecular formula C10H7ClF3N3S and a molecular weight of 293.70 g/mol. Its IUPAC name is 8-chloro-3-prop-2-enylsulfanyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 8-chloro-3-prop-2-enylsulfanyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 78766306 |
| Molecular Formula | C10H7ClF3N3S |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 8-chloro-3-prop-2-enylsulfanyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | C=CCSc1nnc2c(Cl)cc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C10H7ClF3N3S/c1-2-3-18-9-16-15-8-7(11)4-6(5-17(8)9)10(12,13)14/h2,4-5H,1,3H2 |
| InChIKey | CMYIUMSUTRCRJU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|