C18H16N6O2 — CID 5289111
4-N,6-N-bis(pyridin-3-ylmethyl)pyrimidine-4,6-dicarboxamide (PubChem CID 5289111) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-N,6-N-bis(pyridin-3-ylmethyl)pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis(pyridin-3-ylmethyl)pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 5289111 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-N,6-N-bis(pyridin-3-ylmethyl)pyrimidine-4,6-dicarboxamide |
| SMILES | O=C(NCc1cccnc1)c1cc(C(=O)NCc2cccnc2)ncn1 |
| InChI | InChI=1S/C18H16N6O2/c25-17(21-10-13-3-1-5-19-8-13)15-7-16(24-12-23-15)18(26)22-11-14-4-2-6-20-9-14/h1-9,12H,10-11H2,(H,21,25)(H,22,26) |
| InChIKey | NHPBWKYFMTXWAA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |