C18H23F3N2O3S — CID 52891481
N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 52891481) has the molecular formula C18H23F3N2O3S and a molecular weight of 404.45 g/mol. Its IUPAC name is N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 52891481 |
| Molecular Formula | C18H23F3N2O3S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=CCN(CC(=O)N1CCC(C)CC1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H23F3N2O3S/c1-3-9-23(13-17(24)22-10-7-14(2)8-11-22)27(25,26)16-6-4-5-15(12-16)18(19,20)21/h3-6,12,14H,1,7-11,13H2,2H3 |
| InChIKey | MQSOKNGUFCOVSB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|