About R-Azabisabolene
R-Azabisabolene (PubChem CID 5289266) has the molecular formula C14H26N+
and a molecular weight of 208.36 g/mol. Its IUPAC name is methyl-[(1S)-4-methylcyclohex-3-en-1-yl]-(4-methylpent-3-enyl)azanium.
Molecular Properties
| Compound Name | R-Azabisabolene |
| PubChem CID | 5289266 |
| Molecular Formula | C14H26N+ |
| Molecular Weight | 208.36 g/mol |
| Exact Mass | 208.21 |
| IUPAC Name | methyl-[(1S)-4-methylcyclohex-3-en-1-yl]-(4-methylpent-3-enyl)azanium |
| SMILES | CC1=CC[C@H](CC1)[NH+](C)CCC=C(C)C |
| InChI | InChI=1S/C14H25N/c1-12(2)6-5-11-15(4)14-9-7-13(3)8-10-14/h6-7,14H,5,8-11H2,1-4H3/p+1/t14-/m1/s1 |
| InChIKey | GGPFTSMJRHEOJG-CQSZACIVSA-O |
| XLogP | 3.70 |
| TPSA | 4.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 246 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze R-Azabisabolene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of R-Azabisabolene?
The IUPAC name of R-Azabisabolene (CID 5289266) is methyl-[(1S)-4-methylcyclohex-3-en-1-yl]-(4-methylpent-3-enyl)azanium.
What is the SMILES notation for R-Azabisabolene?
The canonical SMILES for R-Azabisabolene is CC1=CC[C@H](CC1)[NH+](C)CCC=C(C)C.
What is the InChIKey of R-Azabisabolene?
The InChIKey is GGPFTSMJRHEOJG-CQSZACIVSA-O. The full InChI is InChI=1S/C14H25N/c1-12(2)6-5-11-15(4)14-9-7-13(3)8-10-14/h6-7,14H,5,8-11H2,1-4H3/p+1/t14-/m1/s1.
What are the key properties of R-Azabisabolene?
R-Azabisabolene has a molecular weight of 208.36 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for R-Azabisabolene is sourced from PubChem (CID 5289266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).