C23H27N3O — CID 52894444
1-[(2R)-2-ethylpiperidin-1-yl]-3-(1-phenylbenzimidazol-2-yl)propan-1-one (PubChem CID 52894444) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-[(2R)-2-ethylpiperidin-1-yl]-3-(1-phenylbenzimidazol-2-yl)propan-1-one.
| Compound Name | 1-[(2R)-2-ethylpiperidin-1-yl]-3-(1-phenylbenzimidazol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 52894444 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[(2R)-2-ethylpiperidin-1-yl]-3-(1-phenylbenzimidazol-2-yl)propan-1-one |
| SMILES | CC[C@@H]1CCCCN1C(=O)CCc1nc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H27N3O/c1-2-18-10-8-9-17-25(18)23(27)16-15-22-24-20-13-6-7-14-21(20)26(22)19-11-4-3-5-12-19/h3-7,11-14,18H,2,8-10,15-17H2,1H3/t18-/m1/s1 |
| InChIKey | DBZYIUSHRZIKBR-GOSISDBHSA-N |
| XLogP | 4.75 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |