C23H27N3O — CID 40633314
N-[(1R,2R)-2-methylcyclohexyl]-3-(1-phenylbenzimidazol-2-yl)propanamide (PubChem CID 40633314) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-3-(1-phenylbenzimidazol-2-yl)propanamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-3-(1-phenylbenzimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 40633314 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-3-(1-phenylbenzimidazol-2-yl)propanamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)CCc1nc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H27N3O/c1-17-9-5-6-12-19(17)25-23(27)16-15-22-24-20-13-7-8-14-21(20)26(22)18-10-3-2-4-11-18/h2-4,7-8,10-11,13-14,17,19H,5-6,9,12,15-16H2,1H3,(H,25,27)/t17-,19-/m1/s1 |
| InChIKey | VFBGUFSGNXJUPV-IEBWSBKVSA-N |
| XLogP | 4.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |