C14H14Cl2N2O2S — CID 52899426
2-(2,6-dichlorophenyl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 52899426) has the molecular formula C14H14Cl2N2O2S and a molecular weight of 345.25 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 52899426 |
| Molecular Formula | C14H14Cl2N2O2S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COCCNC(=O)c1sc(-c2c(Cl)cccc2Cl)nc1C |
| InChI | InChI=1S/C14H14Cl2N2O2S/c1-8-12(13(19)17-6-7-20-2)21-14(18-8)11-9(15)4-3-5-10(11)16/h3-5H,6-7H2,1-2H3,(H,17,19) |
| InChIKey | RYUCZGHRGLNGCZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|