C18H21ClN4O2S — CID 52904460
5-chloro-N-[4-(2,3-dimethylanilino)-4-oxobutyl]-2-methylsulfanylpyrimidine-4-carboxamide (PubChem CID 52904460) has the molecular formula C18H21ClN4O2S and a molecular weight of 392.91 g/mol. Its IUPAC name is 5-chloro-N-[4-(2,3-dimethylanilino)-4-oxobutyl]-2-methylsulfanylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[4-(2,3-dimethylanilino)-4-oxobutyl]-2-methylsulfanylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 52904460 |
| Molecular Formula | C18H21ClN4O2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 5-chloro-N-[4-(2,3-dimethylanilino)-4-oxobutyl]-2-methylsulfanylpyrimidine-4-carboxamide |
| SMILES | CSc1ncc(Cl)c(C(=O)NCCCC(=O)Nc2cccc(C)c2C)n1 |
| InChI | InChI=1S/C18H21ClN4O2S/c1-11-6-4-7-14(12(11)2)22-15(24)8-5-9-20-17(25)16-13(19)10-21-18(23-16)26-3/h4,6-7,10H,5,8-9H2,1-3H3,(H,20,25)(H,22,24) |
| InChIKey | YZZXWMWKXWPXHY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|