C32H23BrN2O3 — CID 5290790
(3Z)-4-(4-bromophenyl)-3-[(4-methoxyphenyl)methylidene]-1,5-diphenyl-4H-pyrrolo[3,4-b]pyrrole-2,6-dione (PubChem CID 5290790) has the molecular formula C32H23BrN2O3 and a molecular weight of 563.45 g/mol. Its IUPAC name is (3Z)-4-(4-bromophenyl)-3-[(4-methoxyphenyl)methylidene]-1,5-diphenyl-4H-pyrrolo[3,4-b]pyrrole-2,6-dione.
| Compound Name | (3Z)-4-(4-bromophenyl)-3-[(4-methoxyphenyl)methylidene]-1,5-diphenyl-4H-pyrrolo[3,4-b]pyrrole-2,6-dione |
|---|---|
| PubChem CID | 5290790 |
| Molecular Formula | C32H23BrN2O3 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | (3Z)-4-(4-bromophenyl)-3-[(4-methoxyphenyl)methylidene]-1,5-diphenyl-4H-pyrrolo[3,4-b]pyrrole-2,6-dione |
| SMILES | COc1ccc(/C=C2\C(=O)N(c3ccccc3)C3=C2C(c2ccc(Br)cc2)N(c2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C32H23BrN2O3/c1-38-26-18-12-21(13-19-26)20-27-28-29(22-14-16-23(33)17-15-22)34(24-8-4-2-5-9-24)32(37)30(28)35(31(27)36)25-10-6-3-7-11-25/h2-20,29H,1H3/b27-20- |
| InChIKey | BXJFFIDPKXVBOZ-OOAXWGSJSA-N |
| XLogP | 6.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|