C31H21FN2O2 — CID 6157896
(3Z)-3-benzylidene-4-(4-fluorophenyl)-1,5-diphenyl-4H-pyrrolo[3,4-b]pyrrole-2,6-dione (PubChem CID 6157896) has the molecular formula C31H21FN2O2 and a molecular weight of 472.52 g/mol. Its IUPAC name is (3Z)-3-benzylidene-4-(4-fluorophenyl)-1,5-diphenyl-4H-pyrrolo[3,4-b]pyrrole-2,6-dione.
| Compound Name | (3Z)-3-benzylidene-4-(4-fluorophenyl)-1,5-diphenyl-4H-pyrrolo[3,4-b]pyrrole-2,6-dione |
|---|---|
| PubChem CID | 6157896 |
| Molecular Formula | C31H21FN2O2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (3Z)-3-benzylidene-4-(4-fluorophenyl)-1,5-diphenyl-4H-pyrrolo[3,4-b]pyrrole-2,6-dione |
| SMILES | O=C1/C(=C\c2ccccc2)C2=C(C(=O)N(c3ccccc3)C2c2ccc(F)cc2)N1c1ccccc1 |
| InChI | InChI=1S/C31H21FN2O2/c32-23-18-16-22(17-19-23)28-27-26(20-21-10-4-1-5-11-21)30(35)34(25-14-8-3-9-15-25)29(27)31(36)33(28)24-12-6-2-7-13-24/h1-20,28H/b26-20- |
| InChIKey | DTFTWOQXYKZKDN-QOMWVZHYSA-N |
| XLogP | 6.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|