C18H22N4O — CID 52910566
N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1-phenylcyclobutane-1-carboxamide (PubChem CID 52910566) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1-phenylcyclobutane-1-carboxamide.
| Compound Name | N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1-phenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 52910566 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-1-phenylcyclobutane-1-carboxamide |
| SMILES | Cc1nnc2n1C[C@@H](NC(=O)C1(c3ccccc3)CCC1)CC2 |
| InChI | InChI=1S/C18H22N4O/c1-13-20-21-16-9-8-15(12-22(13)16)19-17(23)18(10-5-11-18)14-6-3-2-4-7-14/h2-4,6-7,15H,5,8-12H2,1H3,(H,19,23)/t15-/m0/s1 |
| InChIKey | DOIPAHLQVHKMPX-HNNXBMFYSA-N |
| XLogP | 2.14 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |