methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate

C12H20O4 — CID 52912852

IUPACmethyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate
SMILESCCCCOC1CCC(C(=O)OC)=C(C)O1
InChIInChI=1S/C12H20O4/c1-4-5-8-15-11-7-6-10(9(2)16-11)12(13)14-3/h11H,4-8H2,1-3H3
InChIKeyBEFLGGYAAIFJHL-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.39
Rot. Bonds5

About methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate

methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 52912852) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate
PubChem CID52912852
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Namemethyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate
SMILESCCCCOC1CCC(C(=O)OC)=C(C)O1
InChIInChI=1S/C12H20O4/c1-4-5-8-15-11-7-6-10(9(2)16-11)12(13)14-3/h11H,4-8H2,1-3H3
InChIKeyBEFLGGYAAIFJHL-UHFFFAOYSA-N
XLogP2.39
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate?
The IUPAC name of methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate (CID 52912852) is methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate.
What is the SMILES notation for methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate?
The canonical SMILES for methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate is CCCCOC1CCC(C(=O)OC)=C(C)O1.
What is the InChIKey of methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate?
The InChIKey is BEFLGGYAAIFJHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-4-5-8-15-11-7-6-10(9(2)16-11)12(13)14-3/h11H,4-8H2,1-3H3.
What are the key properties of methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate?
methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate has a molecular weight of 228.29 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-butoxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate is sourced from PubChem (CID 52912852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).