C24H31NO6 — CID 52913630
(2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-propan-2-ylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 52913630) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-propan-2-ylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-propan-2-ylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 52913630 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-propan-2-ylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)c1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C24H31NO6/c1-13(2)17-5-4-15(24-23(29)22(28)21(27)20(12-26)31-24)11-16(17)9-14-3-6-19-18(10-14)25-7-8-30-19/h3-6,10-11,13,20-29H,7-9,12H2,1-2H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | KSOOOXHCWVAMAA-SJSRKZJXSA-N |
| XLogP | 1.72 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |