C13H16N2O6 — CID 52915111
1-[(3aR,6S,7aR)-2,2-dimethyl-7-oxo-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 52915111) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 1-[(3aR,6S,7aR)-2,2-dimethyl-7-oxo-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,6S,7aR)-2,2-dimethyl-7-oxo-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 52915111 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[(3aR,6S,7aR)-2,2-dimethyl-7-oxo-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2OC[C@H]3OC(C)(C)O[C@H]3C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H16N2O6/c1-6-4-15(12(18)14-10(6)17)11-8(16)9-7(5-19-11)20-13(2,3)21-9/h4,7,9,11H,5H2,1-3H3,(H,14,17,18)/t7-,9-,11+/m1/s1 |
| InChIKey | ACARHHHOBOQIAS-ZOFUNIGCSA-N |
| XLogP | -0.54 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |