C30H48O5 — CID 52918007
[(2S,4aS,8S,8aS)-8-hydroxy-6-[(1R,2R,3R)-2-(2-hydroxyethyl)-2-methyl-3-[(2R)-6-methyl-5-methylideneheptan-2-yl]cyclopentyl]-4a-methyl-5-oxo-1,2,3,4,8,8a-hexahydronaphthalen-2-yl] acetate (PubChem CID 52918007) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is [(2S,4aS,8S,8aS)-8-hydroxy-6-[(1R,2R,3R)-2-(2-hydroxyethyl)-2-methyl-3-[(2R)-6-methyl-5-methylideneheptan-2-yl]cyclopentyl]-4a-methyl-5-oxo-1,2,3,4,8,8a-hexahydronaphthalen-2-yl] acetate.
| Compound Name | [(2S,4aS,8S,8aS)-8-hydroxy-6-[(1R,2R,3R)-2-(2-hydroxyethyl)-2-methyl-3-[(2R)-6-methyl-5-methylideneheptan-2-yl]cyclopentyl]-4a-methyl-5-oxo-1,2,3,4,8,8a-hexahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 52918007 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | [(2S,4aS,8S,8aS)-8-hydroxy-6-[(1R,2R,3R)-2-(2-hydroxyethyl)-2-methyl-3-[(2R)-6-methyl-5-methylideneheptan-2-yl]cyclopentyl]-4a-methyl-5-oxo-1,2,3,4,8,8a-hexahydronaphthalen-2-yl] acetate |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@@H](C2=C[C@H](O)[C@H]3C[C@@H](OC(C)=O)CC[C@]3(C)C2=O)[C@]1(C)CCO)C(C)C |
| InChI | InChI=1S/C30H48O5/c1-18(2)19(3)8-9-20(4)24-10-11-25(29(24,6)14-15-31)23-17-27(33)26-16-22(35-21(5)32)12-13-30(26,7)28(23)34/h17-18,20,22,24-27,31,33H,3,8-16H2,1-2,4-7H3/t20-,22+,24-,25+,26-,27+,29-,30+/m1/s1 |
| InChIKey | LFZNWUYRISKNIH-QWJARAQCSA-N |
| XLogP | 5.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|