C16H9N3O3S — CID 5291804
(E)-2-(1,3-benzothiazol-2-yl)-3-(4-hydroxy-3-nitrophenyl)prop-2-enenitrile (PubChem CID 5291804) has the molecular formula C16H9N3O3S and a molecular weight of 323.33 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-(4-hydroxy-3-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(4-hydroxy-3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5291804 |
| Molecular Formula | C16H9N3O3S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(4-hydroxy-3-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(O)c([N+](=O)[O-])c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H9N3O3S/c17-9-11(16-18-12-3-1-2-4-15(12)23-16)7-10-5-6-14(20)13(8-10)19(21)22/h1-8,20H/b11-7+ |
| InChIKey | LTPIGUOTELOGDK-YRNVUSSQSA-N |
| XLogP | 3.97 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|