C17H32O3Si — CID 52921110
6-[3-[tert-butyl(dimethyl)silyl]oxypentyl]-4-hydroxycyclohex-2-en-1-one (PubChem CID 52921110) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is 6-[3-[tert-butyl(dimethyl)silyl]oxypentyl]-4-hydroxycyclohex-2-en-1-one.
| Compound Name | 6-[3-[tert-butyl(dimethyl)silyl]oxypentyl]-4-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 52921110 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 6-[3-[tert-butyl(dimethyl)silyl]oxypentyl]-4-hydroxycyclohex-2-en-1-one |
| SMILES | CCC(CCC1CC(O)C=CC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-7-15(20-21(5,6)17(2,3)4)10-8-13-12-14(18)9-11-16(13)19/h9,11,13-15,18H,7-8,10,12H2,1-6H3 |
| InChIKey | AQVULTMDYQBDPN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|