About 3,3-dipropyloxetane
3,3-dipropyloxetane (PubChem CID 529238) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 3,3-dipropyloxetane.
Molecular Properties
| Compound Name | 3,3-dipropyloxetane |
| PubChem CID | 529238 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 3,3-dipropyloxetane |
| SMILES | CCCC1(CCC)COC1 |
| InChI | InChI=1S/C9H18O/c1-3-5-9(6-4-2)7-10-8-9/h3-8H2,1-2H3 |
| InChIKey | KBBVKCOHQLOPLP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dipropyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dipropyloxetane?
The IUPAC name of 3,3-dipropyloxetane (CID 529238) is 3,3-dipropyloxetane.
What is the SMILES notation for 3,3-dipropyloxetane?
The canonical SMILES for 3,3-dipropyloxetane is CCCC1(CCC)COC1.
What is the InChIKey of 3,3-dipropyloxetane?
The InChIKey is KBBVKCOHQLOPLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-3-5-9(6-4-2)7-10-8-9/h3-8H2,1-2H3.
What are the key properties of 3,3-dipropyloxetane?
3,3-dipropyloxetane has a molecular weight of 142.24 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dipropyloxetane is sourced from PubChem (CID 529238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).