C24H24B2N2O4+2 — CID 52931985
[2-[[3-[1-[(2-boronophenyl)methyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]phenyl]boronic acid (PubChem CID 52931985) has the molecular formula C24H24B2N2O4+2 and a molecular weight of 426.09 g/mol. Its IUPAC name is [2-[[3-[1-[(2-boronophenyl)methyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [2-[[3-[1-[(2-boronophenyl)methyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 52931985 |
| Molecular Formula | C24H24B2N2O4+2 |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [2-[[3-[1-[(2-boronophenyl)methyl]pyridin-1-ium-3-yl]pyridin-1-ium-1-yl]methyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccccc1C[n+]1cccc(-c2ccc[n+](Cc3ccccc3B(O)O)c2)c1 |
| InChI | InChI=1S/C24H24B2N2O4/c29-25(30)23-11-3-1-7-21(23)17-27-13-5-9-19(15-27)20-10-6-14-28(16-20)18-22-8-2-4-12-24(22)26(31)32/h1-16,29-32H,17-18H2/q+2 |
| InChIKey | ICWGMUFQXGFOOE-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|