C24H22B2F8N2 — CID 11519119
3-phenyl-1-[2-(3-phenylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium ditetrafluoroborate (PubChem CID 11519119) has the molecular formula C24H22B2F8N2 and a molecular weight of 512.06 g/mol. Its IUPAC name is 3-phenyl-1-[2-(3-phenylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium ditetrafluoroborate.
| Compound Name | 3-phenyl-1-[2-(3-phenylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium ditetrafluoroborate |
|---|---|
| PubChem CID | 11519119 |
| Molecular Formula | C24H22B2F8N2 |
| Molecular Weight | 512.06 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 3-phenyl-1-[2-(3-phenylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium ditetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.c1ccc(-c2ccc[n+](CC[n+]3cccc(-c4ccccc4)c3)c2)cc1 |
| InChI | InChI=1S/C24H22N2.2BF4/c1-3-9-21(10-4-1)23-13-7-15-25(19-23)17-18-26-16-8-14-24(20-26)22-11-5-2-6-12-22;2*2-1(3,4)5/h1-16,19-20H,17-18H2;;/q+2;2*-1 |
| InChIKey | ONORXRNMDACNPM-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.06 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|