C16H19N2O+ — CID 8876238
2-(3-phenylpyridin-1-ium-1-yl)-N-propan-2-ylacetamide (PubChem CID 8876238) has the molecular formula C16H19N2O+ and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-(3-phenylpyridin-1-ium-1-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(3-phenylpyridin-1-ium-1-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 8876238 |
| Molecular Formula | C16H19N2O+ |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-(3-phenylpyridin-1-ium-1-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C[n+]1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H18N2O/c1-13(2)17-16(19)12-18-10-6-9-15(11-18)14-7-4-3-5-8-14/h3-11,13H,12H2,1-2H3/p+1 |
| InChIKey | YNQKFJXGMJHZNJ-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|